| ID: | 23 | |
|---|---|---|
| Name: | Olaquindox | |
| Description: | ||
| Labels: | pH5, Neutral | |
| CAS: | 23696-28-8 | |
| InChi Code: | InChI=1S/C12H13N3O4/c1-8-11(12(17)13-6-7-16)15(19)10-5-3-2-4-9(10)14(8)18/h2-5,16H,6-7H2,1H3,(H,13,17) |
logPeff: Highest logarithmic effective membrane permeability for pH range 3 to 9 [log(cm/s)] i
| Value | Source or prediction |
|---|---|
| -7.18 |
experimental value |
| -7.03 |
Eq4: QSAR model for permeability of drugs and drug-like compounds (Training set) |
| Link | Resource description |
|---|---|
| DTXSID3040726 | US EPA CompTox Dashboard |