ID: | 22 | |
---|---|---|
Name: | Ofloxacin | |
Description: | ||
Labels: | pH9, Ampholyte | |
CAS: | 82419-36-1 | |
InChi Code: | InChI=1S/C18H20FN3O4/c1-10-9-26-17-14-11(16(23)12(18(24)25)8-22(10)14)7-13(19)15(17)21-5-3-20(2)4-6-21/h7-8,10H,3-6,9H2,1-2H3,(H,24,25)/t10-/m1/s1 |
logPeff: Highest logarithmic effective membrane permeability for pH range 3 to 9 [log(cm/s)] i
Value | Source or prediction |
---|---|
-7.47 |
experimental value |
-7.03 |
Eq4: QSAR model for permeability of drugs and drug-like compounds (Training set) |
Link | Resource description |
---|---|
DTXSID3041085 | US EPA CompTox Dashboard |