| ID: | 20 | |
|---|---|---|
| Name: | Nalidixic acid | |
| Description: | ||
| Labels: | pH3, Acid | |
| CAS: | 389-08-2 | |
| InChi Code: | InChI=1S/C12H12N2O3/c1-3-14-6-9(12(16)17)10(15)8-5-4-7(2)13-11(8)14/h4-6H,3H2,1-2H3,(H,16,17) |
logPeff: Highest logarithmic effective membrane permeability for pH range 3 to 9 [log(cm/s)] i
| Value | Source or prediction |
|---|---|
| -4.67 |
experimental value |
| -5.77 |
Eq4: QSAR model for permeability of drugs and drug-like compounds (Training set) |
| Link | Resource description |
|---|---|
| DTXSID3020912 | US EPA CompTox Dashboard |