| ID: | 18 | |
|---|---|---|
| Name: | Marbofloxacin | |
| Description: | ||
| Labels: | pH5, Ampholyte | |
| CAS: | 115550-35-1 | |
| InChi Code: | InChI=1S/C17H19FN4O4/c1-19-3-5-21(6-4-19)14-12(18)7-10-13-16(14)26-9-20(2)22(13)8-11(15(10)23)17(24)25/h7-8H,3-6,9H2,1-2H3,(H,24,25) |
logPeff: Highest logarithmic effective membrane permeability for pH range 3 to 9 [log(cm/s)] i
| Value | Source or prediction |
|---|---|
| -7.51 |
experimental value |
| -7.09 |
Eq4: QSAR model for permeability of drugs and drug-like compounds (Training set) |
| Link | Resource description |
|---|---|
| DTXSID4046600 | US EPA CompTox Dashboard |