| ID: | 17 | |
|---|---|---|
| Name: | Ketoprofen | |
| Description: | ||
| Labels: | pH3, Acid | |
| CAS: | 22071-15-4 | |
| InChi Code: | InChI=1S/C16H14O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19)/t11-/m1/s1 |
logPeff: Highest logarithmic effective membrane permeability for pH range 3 to 9 [log(cm/s)] i
| Value | Source or prediction |
|---|---|
| -4.45 |
experimental value |
| -5.03 |
Eq4: QSAR model for permeability of drugs and drug-like compounds (Training set) |
| Link | Resource description |
|---|---|
| DTXSID6020771 | US EPA CompTox Dashboard |