| ID: | 16 | |
|---|---|---|
| Name: | Guanabenz | |
| Description: | ||
| Labels: | pH9, Base | |
| CAS: | 5051-62-7 | |
| InChi Code: | InChI=1S/C8H8Cl2N4/c9-6-2-1-3-7(10)5(6)4-13-14-8(11)12/h1-4H,(H4,11,12,14)/b13-4+ |
logPeff: Highest logarithmic effective membrane permeability for pH range 3 to 9 [log(cm/s)] i
| Value | Source or prediction |
|---|---|
| -5.98 |
experimental value |
| -6.54 |
Eq4: QSAR model for permeability of drugs and drug-like compounds (Training set) |
| Link | Resource description |
|---|---|
| DTXSID6045666 | US EPA CompTox Dashboard |