| ID: | 13 | |
|---|---|---|
| Name: | Difloxacin | |
| Description: | ||
| Labels: | pH7.4, Ampholyte | |
| CAS: | 98106-17-3 | |
| InChi Code: | InChI=1S/C21H19F2N3O3/c1-24-6-8-25(9-7-24)19-11-18-15(10-17(19)23)20(27)16(21(28)29)12-26(18)14-4-2-13(22)3-5-14/h2-5,10-12H,6-9H2,1H3,(H,28,29) |
logPeff: Highest logarithmic effective membrane permeability for pH range 3 to 9 [log(cm/s)] i
| Value | Source or prediction |
|---|---|
| -6.03 |
experimental value |
| -6.7 |
Eq4: QSAR model for permeability of drugs and drug-like compounds (Training set) |
| Link | Resource description |
|---|---|
| DTXSID5048348 | US EPA CompTox Dashboard |