| ID: | 64 | |
|---|---|---|
| Name: | 2-hydroxybenzaldehyde | |
| Description: | ||
| Labels: | ||
| CAS: | 90-02-8 | |
| InChi Code: | InChI=1S/C7H6O2/c8-5-6-3-1-2-4-7(6)9/h1-5,9H |
pIGC50: 40-h Tetrahymena toxicity as log(1/IGC50) [log(L/mol)] i
| Value | Source or prediction |
|---|---|
| 0.42 |
experimental value |
| 0.2472 |
TabS1: Polar narcotics (Taining set) |
| Link | Resource description |
|---|---|
| DTXSID1021792 | US EPA CompTox Dashboard |