| ID: | 47 | |
|---|---|---|
| Name: | syringaldehyde | |
| Description: | ||
| Labels: | ||
| CAS: | 134-96-3 | |
| InChi Code: | InChI=1S/C9H10O4/c1-12-7-3-6(5-10)4-8(13-2)9(7)11/h3-5,11H,1-2H3 |
pIGC50: 40-h Tetrahymena toxicity as log(1/IGC50) [log(L/mol)] i
| Value | Source or prediction |
|---|---|
| 0.17 |
experimental value |
| -0.4523 |
TabS1: Polar narcotics (Taining set) |
| Link | Resource description |
|---|---|
| DTXSID2059643 | US EPA CompTox Dashboard |