| ID: | 40 | |
|---|---|---|
| Name: | 2,5-dimethylphenol | |
| Description: | ||
| Labels: | ||
| CAS: | 95-87-4 | |
| InChi Code: | InChI=1S/C8H10O/c1-6-3-4-7(2)8(9)5-6/h3-5,9H,1-2H3 |
pIGC50: 40-h Tetrahymena toxicity as log(1/IGC50) [log(L/mol)] i
| Value | Source or prediction |
|---|---|
| 0.08 |
experimental value |
| 0.6186 |
TabS1: Polar narcotics (Taining set) |
| Link | Resource description |
|---|---|
| DTXSID6025145 | US EPA CompTox Dashboard |