| ID: | 10 | |
|---|---|---|
| Name: | Diethyl acetaldehyde | |
| Description: | ||
| Labels: | Training | |
| CAS: | 97-96-1 | |
| InChi Code: | InChI=1S/C6H12O/c1-3-6(4-2)5-7/h5-6H,3-4H2,1-2H3 |
pEC3: Skin sensitization potency in the local lymph node assay (LLNA) as log(1/EC3) [log(L/mol)] i
| Value | Source or prediction |
|---|---|
| 0.17 |
experimental value |
| 0.187 |
Eq1: Model for Schiff base aldehydes (Training set) |
| 0.178 |
Eq3: Model for all Schiff base formers, up to logP = 4 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID3049380 | US EPA CompTox Dashboard |