ID: | 36 | |
---|---|---|
Name: | 1-[(E)-2-{2-methyl-4-[(E)-2-(2-methylphenyl)diazen-1-yl]phenyl}diazen-1-yl]naphthalen-2-ol | |
Description: | ||
Labels: | Training | |
CAS: | 85-83-6 | |
InChi Code: | InChI=1S/C24H20N4O/c1-16-7-3-6-10-21(16)26-25-19-12-13-22(17(2)15-19)27-28-24-20-9-5-4-8-18(20)11-14-23(24)29/h3-15,29H,1-2H3/b26-25+,28-27+ |
BCF_class: Experimental BCF class (nB - non-bio-accumulative, B - bioaccumulative)
Value | Source or prediction |
---|---|
nB |
experimental value |
nB |
Tab1.Model1: Imbalanced model towards nB-compounds (Training set) |
B |
Tab1.Model1: Imbalanced model towards nB-compounds (Out of bag set) |
B |
Tab1.Model2: Balanced model (Training set) |
B |
Tab1.Model2: Balanced model (Out of bag set) |
B |
Tab1.Model3: Imbalanced model towards B-compounds (Training set) |
B |
Tab1.Model3: Imbalanced model towards B-compounds (Out of bag set) |
logBCF: Experimental logarithmic BCF
Value | Source or prediction |
---|---|
0.752 |
experimental value |