Piir, G.; Sild, S.; Roncaglioni, A.; Benfenati, E.; Maran, U. QSAR model for the prediction of bio-concentration factor using aqueous solubility and descriptors considering various electronic effects. SAR QSAR Environ. Res. 2010, 21, 7-8, 711-729.
Compound
| ID: | p159 | |
|---|---|---|
| Name: | hexachlorobenzene | |
| Description: | ||
| Labels: | Validation, 1 | |
| CAS: | 118-74-1 | |
| InChi Code: | InChI=1S/C6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
Properties
LogBCF: Fish bioconcentration factor as logBCF
| Value | Source or prediction |
|---|---|
| 4.23 |
experimental value |
| 3.5917 |
Tab2: Multilinear model for diverse chemicals (External validation set 1) |
| 3.5917 |
Tab3: Multilinear model for diverse chemicals (Tab3*, statistical outliers (Tab4) removed) (External validation set 1) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID2020682 | US EPA CompTox Dashboard |