| ID: | 73 | |
|---|---|---|
| Name: | 1,4-Dithiothreitol | |
| Description: | ||
| Labels: | Training | |
| CAS: | 3483-12-3 | |
| InChi Code: | InChI=1S/C4H10O2S2/c5-3(1-7)4(6)2-8/h3-8H,1-2H2/t3-,4-/m1/s1 |
logLC50: 48-h Daphnia toxicity as log(LC50) [log(mol/L)]
| Value | Source or prediction |
|---|---|
| -3.757 |
experimental value |
| -3.3595 |
Tab2: Model for diverse chemicals (Training set) |