| ID: | 163 | |
|---|---|---|
| Name: | 3,5-Dichlorobenzenamine | |
| Description: | ||
| Labels: | Training | |
| CAS: | 626-43-7 | |
| InChi Code: | InChI=1S/C6H5Cl2N/c7-4-1-5(8)3-6(9)2-4/h1-3H,9H2 |
logLC50: 48-h Daphnia toxicity as log(LC50) [log(mol/L)]
| Value | Source or prediction |
|---|---|
| -5.16 |
experimental value |
| -5.0409 |
Tab2: Model for diverse chemicals (Training set) |
| Link | Resource description |
|---|---|
| DTXSID7030307 | US EPA CompTox Dashboard |