ID: | 6 | |
---|---|---|
Name: | Dicetyl peroxydicarbonate | |
Description: | Name changed. Original (Biscetyl peroxydicarbonate) | |
Labels: | Training | |
CAS: | 26322-14-5 | |
InChi Code: | InChI=1S/C34H66O6/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-37-33(35)39-40-34(36)38-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-32H2,1-2H3 |
SADT: Self-accelerating decomposition temperature [°C]
Value | Source or prediction |
---|---|
19.9 |
Bosch, C. M.; Velo, E.; Recasens, F. Safe storage temperature of peroxide initiators: prediction of self-accelerated decomposition temperature based on a runaway heuristics. Chemical Engineering Science 2001, 56, 1451-1457. http://dx.doi.org/10.1016/s0009-2509(00)00370-5 |
12.88 |
Eq3: Model for self-accelerating decomposition temperature (Training set) |
Link | Resource description |
---|---|
DTXSID1051937 | US EPA CompTox Dashboard |